3824.78.00.00
| Heading/ Subheading |
Stat Suffix | Article Description | Unit of Quantity | General (column 1) | Special (column 1) | Column 2 |
|---|---|---|---|---|---|---|
| 3824 | Prepared binders for foundry molds or cores; chemical products and preparationsof the chemical or allied industries (including those consisting of mixtures of natural products),not elsewhere specified or included: | n/a | n/a | n/a | n/a | |
| 3824 78 00 | 00 | Containingperfluorocarbons (PFCs) or hydrofluorocarbons (HFCs), but not containing chlorofluorocarbons(CFCs) or hydrochlorofluorocarbons (HCFCs) | kg | 3.7% | Free(A+,AU,BH,CA,CL,D,E,IL,J,JO,MA,MX,OM,P,PE,SG) | 25% |